C17H29ClN2O — CID 120728273
2-[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120728273) has the molecular formula C17H29ClN2O and a molecular weight of 312.88 g/mol. Its IUPAC name is 2-[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 2-[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120728273 |
| Molecular Formula | C17H29ClN2O |
| Molecular Weight | 312.88 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(C)Oc1cccc(CN2CCCC(CCN)C2)c1.Cl |
| InChI | InChI=1S/C17H28N2O.ClH/c1-14(2)20-17-7-3-5-16(11-17)13-19-10-4-6-15(12-19)8-9-18;/h3,5,7,11,14-15H,4,6,8-10,12-13,18H2,1-2H3;1H |
| InChIKey | OSRGGJVDAJERHQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |