C16H27ClN2O — CID 119915719
[1-[(3-propan-2-yloxyphenyl)methyl]piperidin-3-yl]methanamine;hydrochloride (PubChem CID 119915719) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is [1-[(3-propan-2-yloxyphenyl)methyl]piperidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[(3-propan-2-yloxyphenyl)methyl]piperidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119915719 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [1-[(3-propan-2-yloxyphenyl)methyl]piperidin-3-yl]methanamine;hydrochloride |
| SMILES | CC(C)Oc1cccc(CN2CCCC(CN)C2)c1.Cl |
| InChI | InChI=1S/C16H26N2O.ClH/c1-13(2)19-16-7-3-5-14(9-16)11-18-8-4-6-15(10-17)12-18;/h3,5,7,9,13,15H,4,6,8,10-12,17H2,1-2H3;1H |
| InChIKey | YKQAHNXTGYTRHW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |