C15H21F2NO — CID 145119200
(3R)-1-[[3-(difluoromethoxy)phenyl]methyl]-3-ethylpiperidine (PubChem CID 145119200) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is (3R)-1-[[3-(difluoromethoxy)phenyl]methyl]-3-ethylpiperidine.
| Compound Name | (3R)-1-[[3-(difluoromethoxy)phenyl]methyl]-3-ethylpiperidine |
|---|---|
| PubChem CID | 145119200 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (3R)-1-[[3-(difluoromethoxy)phenyl]methyl]-3-ethylpiperidine |
| SMILES | CC[C@@H]1CCCN(Cc2cccc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C15H21F2NO/c1-2-12-6-4-8-18(10-12)11-13-5-3-7-14(9-13)19-15(16)17/h3,5,7,9,12,15H,2,4,6,8,10-11H2,1H3/t12-/m1/s1 |
| InChIKey | CRPJNBLSMLQSQA-GFCCVEGCSA-N |
| XLogP | 3.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |