C20H33N3S — CID 70740799
1-methyl-4-[1-[1-[(3-methylsulfanylphenyl)methyl]piperidin-4-yl]ethyl]piperazine (PubChem CID 70740799) has the molecular formula C20H33N3S and a molecular weight of 347.57 g/mol. Its IUPAC name is 1-methyl-4-[1-[1-[(3-methylsulfanylphenyl)methyl]piperidin-4-yl]ethyl]piperazine.
| Compound Name | 1-methyl-4-[1-[1-[(3-methylsulfanylphenyl)methyl]piperidin-4-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 70740799 |
| Molecular Formula | C20H33N3S |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 1-methyl-4-[1-[1-[(3-methylsulfanylphenyl)methyl]piperidin-4-yl]ethyl]piperazine |
| SMILES | CSc1cccc(CN2CCC(C(C)N3CCN(C)CC3)CC2)c1 |
| InChI | InChI=1S/C20H33N3S/c1-17(23-13-11-21(2)12-14-23)19-7-9-22(10-8-19)16-18-5-4-6-20(15-18)24-3/h4-6,15,17,19H,7-14,16H2,1-3H3 |
| InChIKey | DPLRSPXYHGWOPA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |