C20H33N3O2 — CID 95135561
2-methoxy-6-[[4-[(1S)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]methyl]phenol (PubChem CID 95135561) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-methoxy-6-[[4-[(1S)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-6-[[4-[(1S)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 95135561 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 2-methoxy-6-[[4-[(1S)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]methyl]phenol |
| SMILES | COc1cccc(CN2CCC([C@H](C)N3CCN(C)CC3)CC2)c1O |
| InChI | InChI=1S/C20H33N3O2/c1-16(23-13-11-21(2)12-14-23)17-7-9-22(10-8-17)15-18-5-4-6-19(25-3)20(18)24/h4-6,16-17,24H,7-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | DDHOQNAHQHZBIJ-INIZCTEOSA-N |
| XLogP | 2.25 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|