C14H19F3N2O2 — CID 82962319
2-methoxy-6-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenol (PubChem CID 82962319) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-methoxy-6-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-6-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 82962319 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-methoxy-6-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenol |
| SMILES | COc1cccc(CN2CCN(CC(F)(F)F)CC2)c1O |
| InChI | InChI=1S/C14H19F3N2O2/c1-21-12-4-2-3-11(13(12)20)9-18-5-7-19(8-6-18)10-14(15,16)17/h2-4,20H,5-10H2,1H3 |
| InChIKey | HVBXIAMSIZQHET-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|