C16H23NO6 — CID 163328183
2-methoxy-6-[(4-methylpiperidin-1-yl)methyl]phenol;oxalic acid (PubChem CID 163328183) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-methoxy-6-[(4-methylpiperidin-1-yl)methyl]phenol;oxalic acid.
| Compound Name | 2-methoxy-6-[(4-methylpiperidin-1-yl)methyl]phenol;oxalic acid |
|---|---|
| PubChem CID | 163328183 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-methoxy-6-[(4-methylpiperidin-1-yl)methyl]phenol;oxalic acid |
| SMILES | COc1cccc(CN2CCC(C)CC2)c1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H21NO2.C2H2O4/c1-11-6-8-15(9-7-11)10-12-4-3-5-13(17-2)14(12)16;3-1(4)2(5)6/h3-5,11,16H,6-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ZAZJSOVSJOLVAT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|