C22H32N2O7 — CID 123132440
[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-(4-methylpiperidin-1-yl)methanone;oxalic acid (PubChem CID 123132440) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is [1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-(4-methylpiperidin-1-yl)methanone;oxalic acid.
| Compound Name | [1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-(4-methylpiperidin-1-yl)methanone;oxalic acid |
|---|---|
| PubChem CID | 123132440 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-(4-methylpiperidin-1-yl)methanone;oxalic acid |
| SMILES | COc1cccc(CN2CCC(C(=O)N3CCC(C)CC3)CC2)c1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H30N2O3.C2H2O4/c1-15-6-12-22(13-7-15)20(24)16-8-10-21(11-9-16)14-17-4-3-5-18(25-2)19(17)23;3-1(4)2(5)6/h3-5,15-16,23H,6-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | UOPXRCVXJCQQCK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|