C24H34N2O8 — CID 2903679
ethyl 1-[1-[(2-methoxyphenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxylate;oxalic acid (PubChem CID 2903679) has the molecular formula C24H34N2O8 and a molecular weight of 478.54 g/mol. Its IUPAC name is ethyl 1-[1-[(2-methoxyphenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxylate;oxalic acid.
| Compound Name | ethyl 1-[1-[(2-methoxyphenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 2903679 |
| Molecular Formula | C24H34N2O8 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | ethyl 1-[1-[(2-methoxyphenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxylate;oxalic acid |
| SMILES | CCOC(=O)C1CCN(C(=O)C2CCN(Cc3ccccc3OC)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H32N2O4.C2H2O4/c1-3-28-22(26)18-10-14-24(15-11-18)21(25)17-8-12-23(13-9-17)16-19-6-4-5-7-20(19)27-2;3-1(4)2(5)6/h4-7,17-18H,3,8-16H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | PMIFCSQAWHEYHX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|