C21H29ClN2O3 — CID 25249218
ethyl 1-[1-[(3-chlorophenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxylate (PubChem CID 25249218) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is ethyl 1-[1-[(3-chlorophenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-[(3-chlorophenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 25249218 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | ethyl 1-[1-[(3-chlorophenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2CCN(Cc3cccc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C21H29ClN2O3/c1-2-27-21(26)18-8-12-24(13-9-18)20(25)17-6-10-23(11-7-17)15-16-4-3-5-19(22)14-16/h3-5,14,17-18H,2,6-13,15H2,1H3 |
| InChIKey | ZKUZDGJIYNSZQH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |