C20H27ClN2O3 — CID 17152941
ethyl 1-[1-(3-chlorophenyl)piperidine-4-carbonyl]piperidine-4-carboxylate (PubChem CID 17152941) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is ethyl 1-[1-(3-chlorophenyl)piperidine-4-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-(3-chlorophenyl)piperidine-4-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 17152941 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl 1-[1-(3-chlorophenyl)piperidine-4-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2CCN(c3cccc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C20H27ClN2O3/c1-2-26-20(25)16-8-12-23(13-9-16)19(24)15-6-10-22(11-7-15)18-5-3-4-17(21)14-18/h3-5,14-16H,2,6-13H2,1H3 |
| InChIKey | SFRJPTRNZNORLA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |