C22H33N3O4 — CID 43920601
ethyl 4-[1-[(3-ethoxyphenyl)methyl]piperidine-4-carbonyl]piperazine-1-carboxylate (PubChem CID 43920601) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is ethyl 4-[1-[(3-ethoxyphenyl)methyl]piperidine-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-[(3-ethoxyphenyl)methyl]piperidine-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 43920601 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | ethyl 4-[1-[(3-ethoxyphenyl)methyl]piperidine-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2CCN(Cc3cccc(OCC)c3)CC2)CC1 |
| InChI | InChI=1S/C22H33N3O4/c1-3-28-20-7-5-6-18(16-20)17-23-10-8-19(9-11-23)21(26)24-12-14-25(15-13-24)22(27)29-4-2/h5-7,16,19H,3-4,8-15,17H2,1-2H3 |
| InChIKey | OPCFFKHRAACCFU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |