C28H37N3O7 — CID 2903661
[4-(2-ethoxyphenyl)piperazin-1-yl]-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]methanone;oxalic acid (PubChem CID 2903661) has the molecular formula C28H37N3O7 and a molecular weight of 527.62 g/mol. Its IUPAC name is [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]methanone;oxalic acid.
| Compound Name | [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 2903661 |
| Molecular Formula | C28H37N3O7 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]methanone;oxalic acid |
| SMILES | CCOc1ccccc1N1CCN(C(=O)C2CCN(Cc3cccc(OC)c3)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H35N3O3.C2H2O4/c1-3-32-25-10-5-4-9-24(25)28-15-17-29(18-16-28)26(30)22-11-13-27(14-12-22)20-21-7-6-8-23(19-21)31-2;3-1(4)2(5)6/h4-10,19,22H,3,11-18,20H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | SCOGDRDULYAMIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|