C27H34FN3O6 — CID 171151329
[1-[(4-ethoxyphenyl)methyl]piperidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone;oxalic acid (PubChem CID 171151329) has the molecular formula C27H34FN3O6 and a molecular weight of 515.58 g/mol. Its IUPAC name is [1-[(4-ethoxyphenyl)methyl]piperidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone;oxalic acid.
| Compound Name | [1-[(4-ethoxyphenyl)methyl]piperidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 171151329 |
| Molecular Formula | C27H34FN3O6 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | [1-[(4-ethoxyphenyl)methyl]piperidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone;oxalic acid |
| SMILES | CCOc1ccc(CN2CCC(C(=O)N3CCN(c4ccccc4F)CC3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H32FN3O2.C2H2O4/c1-2-31-22-9-7-20(8-10-22)19-27-13-11-21(12-14-27)25(30)29-17-15-28(16-18-29)24-6-4-3-5-23(24)26;3-1(4)2(5)6/h3-10,21H,2,11-19H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | QFINEJMILIAQMW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|