C28H36FN3O7 — CID 650798
[1-[(4-ethoxy-3-methoxyphenyl)methyl]piperidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone;oxalic acid (PubChem CID 650798) has the molecular formula C28H36FN3O7 and a molecular weight of 545.61 g/mol. Its IUPAC name is [1-[(4-ethoxy-3-methoxyphenyl)methyl]piperidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone;oxalic acid.
| Compound Name | [1-[(4-ethoxy-3-methoxyphenyl)methyl]piperidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 650798 |
| Molecular Formula | C28H36FN3O7 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | [1-[(4-ethoxy-3-methoxyphenyl)methyl]piperidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone;oxalic acid |
| SMILES | CCOc1ccc(CN2CCC(C(=O)N3CCN(c4ccccc4F)CC3)CC2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H34FN3O3.C2H2O4/c1-3-33-24-9-8-20(18-25(24)32-2)19-28-12-10-21(11-13-28)26(31)30-16-14-29(15-17-30)23-7-5-4-6-22(23)27;3-1(4)2(5)6/h4-9,18,21H,3,10-17,19H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DYUASIRETULZHC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|