C27H35N3O7 — CID 2903657
[4-(2-ethoxyphenyl)piperazin-1-yl]-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]methanone;oxalic acid (PubChem CID 2903657) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]methanone;oxalic acid.
| Compound Name | [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 2903657 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]methanone;oxalic acid |
| SMILES | CCOc1ccccc1N1CCN(C(=O)C2CCN(Cc3ccccc3O)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H33N3O3.C2H2O4/c1-2-31-24-10-6-4-8-22(24)27-15-17-28(18-16-27)25(30)20-11-13-26(14-12-20)19-21-7-3-5-9-23(21)29;3-1(4)2(5)6/h3-10,20,29H,2,11-19H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ZIVZGJKEQAJRPH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|