C25H32FN3O2 — CID 43922406
[1-[(3-ethoxyphenyl)methyl]piperidin-4-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 43922406) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is [1-[(3-ethoxyphenyl)methyl]piperidin-4-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-[(3-ethoxyphenyl)methyl]piperidin-4-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43922406 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | [1-[(3-ethoxyphenyl)methyl]piperidin-4-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | CCOc1cccc(CN2CCC(C(=O)N3CCN(c4ccc(F)cc4)CC3)CC2)c1 |
| InChI | InChI=1S/C25H32FN3O2/c1-2-31-24-5-3-4-20(18-24)19-27-12-10-21(11-13-27)25(30)29-16-14-28(15-17-29)23-8-6-22(26)7-9-23/h3-9,18,21H,2,10-17,19H2,1H3 |
| InChIKey | SSEWXAKPKXNUFT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |