C23H27ClFN3O — CID 45014849
[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 45014849) has the molecular formula C23H27ClFN3O and a molecular weight of 415.94 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]piperidin-4-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-[(4-chlorophenyl)methyl]piperidin-4-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 45014849 |
| Molecular Formula | C23H27ClFN3O |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]piperidin-4-yl]-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCN(Cc2ccc(Cl)cc2)CC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H27ClFN3O/c24-20-3-1-18(2-4-20)17-26-11-9-19(10-12-26)23(29)28-15-13-27(14-16-28)22-7-5-21(25)6-8-22/h1-8,19H,9-17H2 |
| InChIKey | MIPMHTBKHLHKBG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |