C24H29ClFN3O2 — CID 100684966
[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 100684966) has the molecular formula C24H29ClFN3O2 and a molecular weight of 445.97 g/mol. Its IUPAC name is [1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 100684966 |
| Molecular Formula | C24H29ClFN3O2 |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)C3CCN(Cc4ccc(Cl)cc4F)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H29ClFN3O2/c1-31-22-6-4-21(5-7-22)28-12-14-29(15-13-28)24(30)18-8-10-27(11-9-18)17-19-2-3-20(25)16-23(19)26/h2-7,16,18H,8-15,17H2,1H3 |
| InChIKey | MZKGVQPIKUAAMX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|