C29H35N3O8-2 — CID 20980140
ethyl 4-[1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carbonyl]piperazine-1-carboxylate;oxalate (PubChem CID 20980140) has the molecular formula C29H35N3O8-2 and a molecular weight of 553.61 g/mol. Its IUPAC name is ethyl 4-[1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carbonyl]piperazine-1-carboxylate;oxalate.
| Compound Name | ethyl 4-[1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carbonyl]piperazine-1-carboxylate;oxalate |
|---|---|
| PubChem CID | 20980140 |
| Molecular Formula | C29H35N3O8-2 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | ethyl 4-[1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carbonyl]piperazine-1-carboxylate;oxalate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2CCN(Cc3cccc(OCc4ccccc4)c3)CC2)CC1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/C27H35N3O4.C2H2O4/c1-2-33-27(32)30-17-15-29(16-18-30)26(31)24-11-13-28(14-12-24)20-23-9-6-10-25(19-23)34-21-22-7-4-3-5-8-22;3-1(4)2(5)6/h3-10,19,24H,2,11-18,20-21H2,1H3;(H,3,4)(H,5,6)/p-2 |
| InChIKey | OHMMRTOUNMIFFG-UHFFFAOYSA-L |
| XLogP | 0.26 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|