C20H28ClN3O3 — CID 43920591
ethyl 4-[1-[(3-chlorophenyl)methyl]piperidine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 43920591) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is ethyl 4-[1-[(3-chlorophenyl)methyl]piperidine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-[(3-chlorophenyl)methyl]piperidine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 43920591 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | ethyl 4-[1-[(3-chlorophenyl)methyl]piperidine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2CCCN(Cc3cccc(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C20H28ClN3O3/c1-2-27-20(26)24-11-9-23(10-12-24)19(25)17-6-4-8-22(15-17)14-16-5-3-7-18(21)13-16/h3,5,7,13,17H,2,4,6,8-12,14-15H2,1H3 |
| InChIKey | LQQFNGVVIHXTHT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |