C23H27Cl2N3O — CID 43924118
[1-[(4-chlorophenyl)methyl]piperidin-3-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 43924118) has the molecular formula C23H27Cl2N3O and a molecular weight of 432.40 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]piperidin-3-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-[(4-chlorophenyl)methyl]piperidin-3-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43924118 |
| Molecular Formula | C23H27Cl2N3O |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]piperidin-3-yl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCCN(Cc2ccc(Cl)cc2)C1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H27Cl2N3O/c24-20-8-6-18(7-9-20)16-26-10-2-3-19(17-26)23(29)28-13-11-27(12-14-28)22-5-1-4-21(25)15-22/h1,4-9,15,19H,2-3,10-14,16-17H2 |
| InChIKey | JIYSGPDOEZGCSG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |