C30H34ClN3O — CID 92851226
(4-benzhydrylpiperazin-1-yl)-[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]methanone (PubChem CID 92851226) has the molecular formula C30H34ClN3O and a molecular weight of 488.08 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 92851226 |
| Molecular Formula | C30H34ClN3O |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCN(Cc2ccc(Cl)cc2)C1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H34ClN3O/c31-28-15-13-24(14-16-28)22-32-17-7-12-27(23-32)30(35)34-20-18-33(19-21-34)29(25-8-3-1-4-9-25)26-10-5-2-6-11-26/h1-6,8-11,13-16,27,29H,7,12,17-23H2/t27-/m1/s1 |
| InChIKey | MDJLKVNWJIANTI-HHHXNRCGSA-N |
| XLogP | 5.49 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |