C21H30FN3O3 — CID 47802432
ethyl 4-[[1-[(3-fluorophenyl)methyl]piperidine-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 47802432) has the molecular formula C21H30FN3O3 and a molecular weight of 391.49 g/mol. Its IUPAC name is ethyl 4-[[1-[(3-fluorophenyl)methyl]piperidine-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-[(3-fluorophenyl)methyl]piperidine-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 47802432 |
| Molecular Formula | C21H30FN3O3 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | ethyl 4-[[1-[(3-fluorophenyl)methyl]piperidine-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2CCCN(Cc3cccc(F)c3)C2)CC1 |
| InChI | InChI=1S/C21H30FN3O3/c1-2-28-21(27)25-11-8-19(9-12-25)23-20(26)17-6-4-10-24(15-17)14-16-5-3-7-18(22)13-16/h3,5,7,13,17,19H,2,4,6,8-12,14-15H2,1H3,(H,23,26) |
| InChIKey | CCJQCZLPKYNSLK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |