C21H30FN3O — CID 29085751
(3R)-N-cyclopropyl-1-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 29085751) has the molecular formula C21H30FN3O and a molecular weight of 359.49 g/mol. Its IUPAC name is (3R)-N-cyclopropyl-1-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopropyl-1-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 29085751 |
| Molecular Formula | C21H30FN3O |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | (3R)-N-cyclopropyl-1-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CC1)[C@@H]1CCCN(C2CCN(Cc3cccc(F)c3)CC2)C1 |
| InChI | InChI=1S/C21H30FN3O/c22-18-5-1-3-16(13-18)14-24-11-8-20(9-12-24)25-10-2-4-17(15-25)21(26)23-19-6-7-19/h1,3,5,13,17,19-20H,2,4,6-12,14-15H2,(H,23,26)/t17-/m1/s1 |
| InChIKey | GAYIABVHINHIKH-QGZVFWFLSA-N |
| XLogP | 2.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |