C23H24F3N3O2 — CID 42165144
2-methoxy-6-[[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol (PubChem CID 42165144) has the molecular formula C23H24F3N3O2 and a molecular weight of 431.46 g/mol. Its IUPAC name is 2-methoxy-6-[[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-6-[[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 42165144 |
| Molecular Formula | C23H24F3N3O2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-methoxy-6-[[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol |
| SMILES | COc1cccc(CN2CCC(c3[nH]ncc3-c3cccc(C(F)(F)F)c3)CC2)c1O |
| InChI | InChI=1S/C23H24F3N3O2/c1-31-20-7-3-5-17(22(20)30)14-29-10-8-15(9-11-29)21-19(13-27-28-21)16-4-2-6-18(12-16)23(24,25)26/h2-7,12-13,15,30H,8-11,14H2,1H3,(H,27,28) |
| InChIKey | BZEURHAALUAPAB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|