C23H27N3O2 — CID 42431673
2-methoxy-6-[[4-[4-(3-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol (PubChem CID 42431673) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-methoxy-6-[[4-[4-(3-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-6-[[4-[4-(3-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 42431673 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-methoxy-6-[[4-[4-(3-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol |
| SMILES | COc1cccc(CN2CCC(c3[nH]ncc3-c3cccc(C)c3)CC2)c1O |
| InChI | InChI=1S/C23H27N3O2/c1-16-5-3-6-18(13-16)20-14-24-25-22(20)17-9-11-26(12-10-17)15-19-7-4-8-21(28-2)23(19)27/h3-8,13-14,17,27H,9-12,15H2,1-2H3,(H,24,25) |
| InChIKey | UUQVRSSJQQTJCU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|