C22H23F2N3O2 — CID 42472821
2-[[(3R)-3-[4-(2,5-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]-6-methoxyphenol (PubChem CID 42472821) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[[(3R)-3-[4-(2,5-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]-6-methoxyphenol.
| Compound Name | 2-[[(3R)-3-[4-(2,5-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 42472821 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[[(3R)-3-[4-(2,5-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]-6-methoxyphenol |
| SMILES | COc1cccc(CN2CCC[C@@H](c3[nH]ncc3-c3cc(F)ccc3F)C2)c1O |
| InChI | InChI=1S/C22H23F2N3O2/c1-29-20-6-2-4-15(22(20)28)13-27-9-3-5-14(12-27)21-18(11-25-26-21)17-10-16(23)7-8-19(17)24/h2,4,6-8,10-11,14,28H,3,5,9,12-13H2,1H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | NNJCUOMIWJJKPI-CQSZACIVSA-N |
| XLogP | 4.45 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|