C22H24FN3O2 — CID 42482527
2-[[(3R)-3-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]-4-methoxyphenol (PubChem CID 42482527) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[[(3R)-3-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]-4-methoxyphenol.
| Compound Name | 2-[[(3R)-3-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 42482527 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[[(3R)-3-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CN2CCC[C@@H](c3[nH]ncc3-c3cccc(F)c3)C2)c1 |
| InChI | InChI=1S/C22H24FN3O2/c1-28-19-7-8-21(27)17(11-19)14-26-9-3-5-16(13-26)22-20(12-24-25-22)15-4-2-6-18(23)10-15/h2,4,6-8,10-12,16,27H,3,5,9,13-14H2,1H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | LNZKLONKWLETRM-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|