C21H18F5N3 — CID 45225734
3-[4-(2,5-difluorophenyl)-1H-pyrazol-5-yl]-1-[(2,3,6-trifluorophenyl)methyl]piperidine (PubChem CID 45225734) has the molecular formula C21H18F5N3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 3-[4-(2,5-difluorophenyl)-1H-pyrazol-5-yl]-1-[(2,3,6-trifluorophenyl)methyl]piperidine.
| Compound Name | 3-[4-(2,5-difluorophenyl)-1H-pyrazol-5-yl]-1-[(2,3,6-trifluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 45225734 |
| Molecular Formula | C21H18F5N3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 3-[4-(2,5-difluorophenyl)-1H-pyrazol-5-yl]-1-[(2,3,6-trifluorophenyl)methyl]piperidine |
| SMILES | Fc1ccc(F)c(-c2cn[nH]c2C2CCCN(Cc3c(F)ccc(F)c3F)C2)c1 |
| InChI | InChI=1S/C21H18F5N3/c22-13-3-4-17(23)14(8-13)15-9-27-28-21(15)12-2-1-7-29(10-12)11-16-18(24)5-6-19(25)20(16)26/h3-6,8-9,12H,1-2,7,10-11H2,(H,27,28) |
| InChIKey | MHWZWDPCWAQUKW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|