C21H21F2N3O — CID 45168258
2-[[3-[4-(2,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol (PubChem CID 45168258) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[[3-[4-(2,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-[[3-[4-(2,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 45168258 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[[3-[4-(2,4-difluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenol |
| SMILES | Oc1ccccc1CN1CCCC(c2[nH]ncc2-c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C21H21F2N3O/c22-16-7-8-17(19(23)10-16)18-11-24-25-21(18)15-5-3-9-26(13-15)12-14-4-1-2-6-20(14)27/h1-2,4,6-8,10-11,15,27H,3,5,9,12-13H2,(H,24,25) |
| InChIKey | OJHWUIRAOSSOPX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|