C21H21F3N4 — CID 45180592
3-[[3-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]pyridine (PubChem CID 45180592) has the molecular formula C21H21F3N4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 3-[[3-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]pyridine.
| Compound Name | 3-[[3-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 45180592 |
| Molecular Formula | C21H21F3N4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[[3-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]pyridine |
| SMILES | FC(F)(F)c1cccc(-c2cn[nH]c2C2CCCN(Cc3cccnc3)C2)c1 |
| InChI | InChI=1S/C21H21F3N4/c22-21(23,24)18-7-1-5-16(10-18)19-12-26-27-20(19)17-6-3-9-28(14-17)13-15-4-2-8-25-11-15/h1-2,4-5,7-8,10-12,17H,3,6,9,13-14H2,(H,26,27) |
| InChIKey | DDFPPVUNLJWCSO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |