C27H28F3N3O — CID 42483502
2-methyl-4-[4-[[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenyl]but-3-yn-2-ol (PubChem CID 42483502) has the molecular formula C27H28F3N3O and a molecular weight of 467.54 g/mol. Its IUPAC name is 2-methyl-4-[4-[[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenyl]but-3-yn-2-ol.
| Compound Name | 2-methyl-4-[4-[[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 42483502 |
| Molecular Formula | C27H28F3N3O |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-methyl-4-[4-[[4-[4-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methyl]phenyl]but-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1ccc(CN2CCC(c3[nH]ncc3-c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H28F3N3O/c1-26(2,34)13-10-19-6-8-20(9-7-19)18-33-14-11-21(12-15-33)25-24(17-31-32-25)22-4-3-5-23(16-22)27(28,29)30/h3-9,16-17,21,34H,11-12,14-15,18H2,1-2H3,(H,31,32) |
| InChIKey | ZIMHFKRCUZTXGE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|