C18H26N4OS — CID 45191246
1-[1-[[1-[(3-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]triazol-4-yl]ethanol (PubChem CID 45191246) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[1-[[1-[(3-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]triazol-4-yl]ethanol.
| Compound Name | 1-[1-[[1-[(3-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 45191246 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[1-[[1-[(3-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]triazol-4-yl]ethanol |
| SMILES | CSc1cccc(CN2CCC(Cn3cc(C(C)O)nn3)CC2)c1 |
| InChI | InChI=1S/C18H26N4OS/c1-14(23)18-13-22(20-19-18)12-15-6-8-21(9-7-15)11-16-4-3-5-17(10-16)24-2/h3-5,10,13-15,23H,6-9,11-12H2,1-2H3 |
| InChIKey | IHVYDEYHIPSSQM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |