About benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate
benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate (PubChem CID 168613145) has the molecular formula C16H15N5S2
and a molecular weight of 341.47 g/mol. Its IUPAC name is benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate.
Molecular Properties
| Compound Name | benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate |
| PubChem CID | 168613145 |
| Molecular Formula | C16H15N5S2 |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc2nc(N)sc2c1)SCc1ccccc1 |
| InChI | InChI=1S/C16H15N5S2/c17-15-20-13-7-6-12(8-14(13)23-15)9-19-21-16(18)22-10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,17,20)(H2,18,21) |
| InChIKey | MYNJWQYYQRCATI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate?
The IUPAC name of benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate (CID 168613145) is benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate.
What is the SMILES notation for benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate?
The canonical SMILES for benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate is NC(=NN=Cc1ccc2nc(N)sc2c1)SCc1ccccc1.
What is the InChIKey of benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate?
The InChIKey is MYNJWQYYQRCATI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5S2/c17-15-20-13-7-6-12(8-14(13)23-15)9-19-21-16(18)22-10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,17,20)(H2,18,21).
What are the key properties of benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate?
benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate has a molecular weight of 341.47 g/mol, XLogP of 3.46, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N'-[(2-amino-1,3-benzothiazol-6-yl)methylideneamino]carbamimidothioate is sourced from PubChem (CID 168613145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).