C18H19FN6O2S — CID 168618571
N-[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168618571) has the molecular formula C18H19FN6O2S and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168618571 |
| Molecular Formula | C18H19FN6O2S |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[[4-fluoro-3-[5-(morpholin-4-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccc(F)c(-c3noc(CN4CCOCC4)n3)c2)n1 |
| InChI | InChI=1S/C18H19FN6O2S/c1-12-11-28-18(21-12)23-20-9-13-2-3-15(19)14(8-13)17-22-16(27-24-17)10-25-4-6-26-7-5-25/h2-3,8-9,11H,4-7,10H2,1H3,(H,21,23) |
| InChIKey | OGFJNRKHLPSYEV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|