C18H20N6OS — CID 168619659
4-methyl-N-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168619659) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-methyl-N-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619659 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-methyl-N-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccc(-c3noc(CN4CCCC4)n3)cc2)n1 |
| InChI | InChI=1S/C18H20N6OS/c1-13-12-26-18(20-13)22-19-10-14-4-6-15(7-5-14)17-21-16(25-23-17)11-24-8-2-3-9-24/h4-7,10,12H,2-3,8-9,11H2,1H3,(H,20,22) |
| InChIKey | QDLDMTMXNZCMFT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|