C20H21N5O — CID 169384196
N-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]aniline (PubChem CID 169384196) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]aniline.
| Compound Name | N-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169384196 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylideneamino]aniline |
| SMILES | C(=NNc1ccccc1)c1ccc(-c2noc(CN3CCCC3)n2)cc1 |
| InChI | InChI=1S/C20H21N5O/c1-2-6-18(7-3-1)23-21-14-16-8-10-17(11-9-16)20-22-19(26-24-20)15-25-12-4-5-13-25/h1-3,6-11,14,23H,4-5,12-13,15H2 |
| InChIKey | QIKCPUPTQJQIGW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|