C23H20N4S — CID 168616897
4-methyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168616897) has the molecular formula C23H20N4S and a molecular weight of 384.51 g/mol. Its IUPAC name is 4-methyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168616897 |
| Molecular Formula | C23H20N4S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-methyl-N-[[4-(N-phenylanilino)phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H20N4S/c1-18-17-28-23(25-18)26-24-16-19-12-14-22(15-13-19)27(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-17H,1H3,(H,25,26) |
| InChIKey | UZKIISFDQWQFGR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|