C20H23N5S — CID 168625905
2-N-[[4-(N-butylanilino)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168625905) has the molecular formula C20H23N5S and a molecular weight of 365.51 g/mol. Its IUPAC name is 2-N-[[4-(N-butylanilino)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-(N-butylanilino)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168625905 |
| Molecular Formula | C20H23N5S |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-N-[[4-(N-butylanilino)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | CCCCN(c1ccccc1)c1ccc(C=NNc2nc(N)cs2)cc1 |
| InChI | InChI=1S/C20H23N5S/c1-2-3-13-25(17-7-5-4-6-8-17)18-11-9-16(10-12-18)14-22-24-20-23-19(21)15-26-20/h4-12,14-15H,2-3,13,21H2,1H3,(H,23,24) |
| InChIKey | CWMDNMRRNSQLKS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|