C17H19F3N4S — CID 168617739
4-methyl-N-[[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168617739) has the molecular formula C17H19F3N4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 4-methyl-N-[[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168617739 |
| Molecular Formula | C17H19F3N4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-methyl-N-[[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccc(N3CCCCC3)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H19F3N4S/c1-12-11-25-16(22-12)23-21-10-13-5-6-15(14(9-13)17(18,19)20)24-7-3-2-4-8-24/h5-6,9-11H,2-4,7-8H2,1H3,(H,22,23) |
| InChIKey | RWYYYBYISYTFLJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|