C14H10F3N3S2 — CID 168619215
4-methyl-N-[[3-(trifluoromethyl)-1-benzothiophen-5-yl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168619215) has the molecular formula C14H10F3N3S2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 4-methyl-N-[[3-(trifluoromethyl)-1-benzothiophen-5-yl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[3-(trifluoromethyl)-1-benzothiophen-5-yl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619215 |
| Molecular Formula | C14H10F3N3S2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-methyl-N-[[3-(trifluoromethyl)-1-benzothiophen-5-yl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccc3scc(C(F)(F)F)c3c2)n1 |
| InChI | InChI=1S/C14H10F3N3S2/c1-8-6-22-13(19-8)20-18-5-9-2-3-12-10(4-9)11(7-21-12)14(15,16)17/h2-7H,1H3,(H,19,20) |
| InChIKey | PWSZNIVPWULZID-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|