C12H8Cl2F3N3S — CID 168617137
N-[[2,6-dichloro-3-(trifluoromethyl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168617137) has the molecular formula C12H8Cl2F3N3S and a molecular weight of 354.18 g/mol. Its IUPAC name is N-[[2,6-dichloro-3-(trifluoromethyl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[2,6-dichloro-3-(trifluoromethyl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168617137 |
| Molecular Formula | C12H8Cl2F3N3S |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | N-[[2,6-dichloro-3-(trifluoromethyl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2c(Cl)ccc(C(F)(F)F)c2Cl)n1 |
| InChI | InChI=1S/C12H8Cl2F3N3S/c1-6-5-21-11(19-6)20-18-4-7-9(13)3-2-8(10(7)14)12(15,16)17/h2-5H,1H3,(H,19,20) |
| InChIKey | CAHNEGGADGSWPI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|