C13H11F4N3OS — CID 168616900
4-methyl-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168616900) has the molecular formula C13H11F4N3OS and a molecular weight of 333.31 g/mol. Its IUPAC name is 4-methyl-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168616900 |
| Molecular Formula | C13H11F4N3OS |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-methyl-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2cccc(OC(F)(F)C(F)F)c2)n1 |
| InChI | InChI=1S/C13H11F4N3OS/c1-8-7-22-12(19-8)20-18-6-9-3-2-4-10(5-9)21-13(16,17)11(14)15/h2-7,11H,1H3,(H,19,20) |
| InChIKey | ABVXBNJBYJEEEV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|