C18H15F2N3OS — CID 168617397
N-[[3-[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168617397) has the molecular formula C18H15F2N3OS and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[[3-[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[3-[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168617397 |
| Molecular Formula | C18H15F2N3OS |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[[3-[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2cccc(OCc3ccc(F)c(F)c3)c2)n1 |
| InChI | InChI=1S/C18H15F2N3OS/c1-12-11-25-18(22-12)23-21-9-13-3-2-4-15(7-13)24-10-14-5-6-16(19)17(20)8-14/h2-9,11H,10H2,1H3,(H,22,23) |
| InChIKey | QIKFMLBVINPEJV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|