C20H20N6O4S — CID 172927252
methyl (2E)-2-[(2Z)-4-oxo-2-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172927252) has the molecular formula C20H20N6O4S and a molecular weight of 440.49 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-4-oxo-2-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-4-oxo-2-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172927252 |
| Molecular Formula | C20H20N6O4S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | methyl (2E)-2-[(2Z)-4-oxo-2-[[4-[5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(-c3noc(CN4CCCC4)n3)cc2)NC1=O |
| InChI | InChI=1S/C20H20N6O4S/c1-29-17(27)10-15-19(28)23-20(31-15)24-21-11-13-4-6-14(7-5-13)18-22-16(30-25-18)12-26-8-2-3-9-26/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,23,24,28)/b15-10+,21-11? |
| InChIKey | BSZLOQMZZRHDMG-VTHFHNTBSA-N |
| XLogP | 1.94 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|