C16H9F8N3O3S — CID 172926775
methyl (2E)-2-[(2Z)-4-oxo-2-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926775) has the molecular formula C16H9F8N3O3S and a molecular weight of 475.32 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-4-oxo-2-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-4-oxo-2-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926775 |
| Molecular Formula | C16H9F8N3O3S |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | methyl (2E)-2-[(2Z)-4-oxo-2-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(C(F)(F)F)c(C(F)(F)C(F)(F)F)c2)NC1=O |
| InChI | InChI=1S/C16H9F8N3O3S/c1-30-11(28)5-10-12(29)26-13(31-10)27-25-6-7-2-3-8(15(19,20)21)9(4-7)14(17,18)16(22,23)24/h2-6H,1H3,(H,26,27,29)/b10-5+,25-6? |
| InChIKey | CVUCFHTUUGSMQF-LVRDNGNGSA-N |
| XLogP | 3.97 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|