C14H9F3IN3O3S — CID 172926749
methyl (2E)-2-[(2Z)-2-[[3-iodo-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926749) has the molecular formula C14H9F3IN3O3S and a molecular weight of 483.21 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[3-iodo-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[3-iodo-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926749 |
| Molecular Formula | C14H9F3IN3O3S |
| Molecular Weight | 483.21 g/mol |
| Exact Mass | 482.94 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[3-iodo-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(I)cc(C(F)(F)F)c2)NC1=O |
| InChI | InChI=1S/C14H9F3IN3O3S/c1-24-11(22)5-10-12(23)20-13(25-10)21-19-6-7-2-8(14(15,16)17)4-9(18)3-7/h2-6H,1H3,(H,20,21,23)/b10-5+,19-6? |
| InChIKey | RTBUMYSEUKIJQT-GPTIZCITSA-N |
| XLogP | 2.92 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|