C20H24N4O3S — CID 172925073
methyl (2E)-2-[(2Z)-2-[[4-[(3-methylpiperidin-1-yl)methyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172925073) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[4-[(3-methylpiperidin-1-yl)methyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[4-[(3-methylpiperidin-1-yl)methyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172925073 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[4-[(3-methylpiperidin-1-yl)methyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(CN3CCCC(C)C3)cc2)NC1=O |
| InChI | InChI=1S/C20H24N4O3S/c1-14-4-3-9-24(12-14)13-16-7-5-15(6-8-16)11-21-23-20-22-19(26)17(28-20)10-18(25)27-2/h5-8,10-11,14H,3-4,9,12-13H2,1-2H3,(H,22,23,26)/b17-10+,21-11? |
| InChIKey | DRESPAREODWKMT-FVMKLKLVSA-N |
| XLogP | 2.53 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|