C21H19N7O4S — CID 172927256
methyl (2E)-2-[(2Z)-2-[[3-[5-[(2-ethylimidazol-1-yl)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172927256) has the molecular formula C21H19N7O4S and a molecular weight of 465.50 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[3-[5-[(2-ethylimidazol-1-yl)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[3-[5-[(2-ethylimidazol-1-yl)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172927256 |
| Molecular Formula | C21H19N7O4S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[3-[5-[(2-ethylimidazol-1-yl)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCc1nccn1Cc1nc(-c2cccc(C=N/N=C3/NC(=O)/C(=C\C(=O)OC)S3)c2)no1 |
| InChI | InChI=1S/C21H19N7O4S/c1-3-16-22-7-8-28(16)12-17-24-19(27-32-17)14-6-4-5-13(9-14)11-23-26-21-25-20(30)15(33-21)10-18(29)31-2/h4-11H,3,12H2,1-2H3,(H,25,26,30)/b15-10+,23-11? |
| InChIKey | WVLYVEPIEFVMIO-AOXSVMFBSA-N |
| XLogP | 2.15 |
| TPSA | 136.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|